CAS 1228880-44-1

1,3,4-Thiadiazole-2-ethanamine, 5-(1-methylethyl)-, hydrochloride (1:1)

Description:

1,3,4-Thiadiazole-2-ethanamine, 5-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and one sulfur atom. This compound features an ethylamine side chain, contributing to its amine functionality, and a branched isopropyl group, which may influence its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the thiadiazole moiety suggests potential biological activity, as many thiadiazole derivatives are known for their antimicrobial, anti-inflammatory, and anticancer properties. The compound's specific interactions and effects would depend on its molecular structure and the presence of functional groups, which can influence its reactivity and biological interactions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₇H₁₃N₃S·ClH

InChI: InChI=1S/C7H13N3S.ClH/c1-5(2)7-10-9-6(11-7)3-4-8;/h5H,3-4,8H2,1-2H3;1H

InChI key: InChIKey=RNJXTDMZDNCMAB-UHFFFAOYSA-N

SMILES: C(C)(C)C=1SC(CCN)=NN1.Cl

Synonyms:

• 1,3,4-Thiadiazole-2-ethanamine, 5-(1-methylethyl)-, hydrochloride (1:1)