CymitQuimica logo

CAS 122892-53-9

:

N-{4-[2-(dimethylamino)ethoxy]benzyl}-3-methoxybenzamide

Description:
N-{4-[2-(dimethylamino)ethoxy]benzyl}-3-methoxybenzamide, with the CAS number 122892-53-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzamide core substituted with both a methoxy group and a dimethylaminoethoxy side chain. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to the presence of the dimethylamino group, which can influence its interaction with biological targets. The methoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can be relevant in drug design and molecular recognition processes. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity.
Formula:C19H24N2O3
InChI:InChI=1/C19H24N2O3/c1-21(2)11-12-24-17-9-7-15(8-10-17)14-20-19(22)16-5-4-6-18(13-16)23-3/h4-10,13H,11-12,14H2,1-3H3,(H,20,22)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.