CAS 122894-67-1

2-(1-Piperidinylmethyl)morpholine

Description:

2-(1-Piperidinylmethyl)morpholine, with the CAS number 122894-67-1, is a chemical compound characterized by its unique structure that combines a morpholine ring with a piperidine moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. The presence of both morpholine and piperidine rings contributes to its basicity and solubility in polar solvents, making it versatile in chemical reactions. Additionally, the compound may exhibit biological activity, which can be explored in drug development. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health risks if not managed properly. Overall, 2-(1-Piperidinylmethyl)morpholine is an interesting compound with significant implications in chemical research and development.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-2-5-12(6-3-1)9-10-8-11-4-7-13-10/h10-11H,1-9H2

InChI key: InChIKey=AZDXOXWFGNQSPC-UHFFFAOYSA-N

SMILES: C(C1CNCCO1)N2CCCCC2

Synonyms:

• 2-Piperidin-1-ylmethylmorpholine
• Morpholine, 2-(1-piperidinylmethyl)-
• 2-(1-Piperidinylmethyl)morpholine

Morpholine, 2-(1-piperidinylmethyl)-

CAS: 122894-67-1

Formula: C₁₀H₂₀N₂O

Molecular weight: 184.2786

Ref: IN-DA000JPL