CymitQuimica logo

CAS 1228956-95-3

:

Phenylmethyl 3-[[(phenylmethoxy)carbonyl]amino]-2-pyridinecarboxylate

Description:
Phenylmethyl 3-[[(phenylmethoxy)carbonyl]amino]-2-pyridinecarboxylate, identified by its CAS number 1228956-95-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. This compound features an ester functional group due to the presence of the phenylmethyl and carboxylate moieties, contributing to its potential reactivity and solubility properties. The presence of the phenylmethoxy group suggests that it may exhibit aromatic characteristics, which can influence its electronic properties and interactions with other molecules. Additionally, the amino group indicates potential for hydrogen bonding, which can affect its biological activity and solubility in various solvents. The compound's structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its diverse functional groups. Overall, the characteristics of this compound suggest a versatile chemical with potential applications in various fields, including drug design and synthesis.
Formula:C21H18N2O4
InChI:InChI=1S/C21H18N2O4/c24-20(26-14-16-8-3-1-4-9-16)19-18(12-7-13-22-19)23-21(25)27-15-17-10-5-2-6-11-17/h1-13H,14-15H2,(H,23,25)
InChI key:InChIKey=HJZNKUHGIWQTLI-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2=C(NC(OCC3=CC=CC=C3)=O)C=CC=N2
Synonyms:
  • Phenylmethyl 3-[[(phenylmethoxy)carbonyl]amino]-2-pyridinecarboxylate
  • 2-Pyridinecarboxylic acid, 3-[[(phenylmethoxy)carbonyl]amino]-, phenylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.