CymitQuimica logo

CAS 1228957-01-4

:

1,1-Dimethylethyl 4-(4-bromo-2-methoxyphenoxy)-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-(4-bromo-2-methoxyphenoxy)-1-piperidinecarboxylate, identified by its CAS number 1228957-01-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a phenoxy moiety substituted with a bromine and a methoxy group. This compound is typically classified as an organic ester and may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity, while the methoxy group may enhance lipophilicity. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological properties. Additionally, the presence of the dimethyl group suggests steric hindrance, which can affect the compound's interaction with biological targets. Overall, this compound's unique structural features may contribute to its specific applications in research and industry.
Formula:C17H24BrNO4
InChI:InChI=1S/C17H24BrNO4/c1-17(2,3)23-16(20)19-9-7-13(8-10-19)22-14-6-5-12(18)11-15(14)21-4/h5-6,11,13H,7-10H2,1-4H3
InChI key:InChIKey=GWWSAEPVIJIXPB-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=C(Br)C=C1)C2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 4-(4-bromo-2-methoxyphenoxy)-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-(4-bromo-2-methoxyphenoxy)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.