CymitQuimica logo

CAS 1228957-05-8

:

Ethyl α,α,2,4-tetrafluorobenzeneacetate

Description:
Ethyl α,α,2,4-tetrafluorobenzeneacetate is a fluorinated organic compound characterized by the presence of a benzene ring substituted with four fluorine atoms and an ethyl ester functional group. The fluorine substitutions typically enhance the compound's chemical stability, lipophilicity, and potential biological activity. This compound is likely to exhibit unique physical properties, such as altered boiling and melting points compared to its non-fluorinated counterparts, due to the electronegative nature of fluorine. Additionally, the presence of the ester group suggests that it may undergo hydrolysis in the presence of water or basic conditions, leading to the formation of the corresponding acid and alcohol. Ethyl α,α,2,4-tetrafluorobenzeneacetate may find applications in various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated compounds that can impart desirable characteristics such as increased potency or improved solubility. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with fluorinated compounds.
Formula:C10H8F4O2
InChI:InChI=1S/C10H8F4O2/c1-2-16-9(15)10(13,14)7-4-3-6(11)5-8(7)12/h3-5H,2H2,1H3
InChI key:InChIKey=YAKBPASPIJTDDM-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(F)(F)C1=C(F)C=C(F)C=C1
Synonyms:
  • Benzeneacetic acid, α,α,2,4-tetrafluoro-, ethyl ester
  • Ethyl α,α,2,4-tetrafluorobenzeneacetate
Found 4 products.