CAS 1228957-07-0

1-Bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)benzene

Description:

1-Bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)benzene is an organic compound characterized by the presence of a bromine atom, a fluorine atom, and two methoxy groups attached to a benzene ring. This compound features a complex aromatic structure, which contributes to its chemical stability and potential reactivity. The bromine and fluorine substituents can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The methoxy groups enhance the solubility of the compound in organic solvents and may also affect its polarity and reactivity. Additionally, the presence of the phenylmethoxy group introduces steric hindrance, which can impact the compound's reactivity and interactions with other molecules. Overall, 1-Bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)benzene is a versatile compound that may find applications in pharmaceuticals, agrochemicals, and materials science due to its unique structural features and functional groups.

Formula: C₁₄H₁₂BrFO₂

InChI: InChI=1S/C14H12BrFO2/c1-17-14-11(15)7-8-12(13(14)16)18-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3

InChI key: InChIKey=YQSYBUBTVOCLQD-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(F)C(OC)=C(Br)C=C2

Synonyms:

• 1-(Benzyloxy)-4-bromo-2-fluoro-3-methoxybenzene
• 1-Bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)benzene
• Benzene, 1-bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)-

Benzene, 1-bromo-3-fluoro-2-methoxy-4-(phenylmethoxy)-

CAS: 1228957-07-0

Formula: C₁₄H₁₂BrFO₂

Purity: 97%

Molecular weight: 311.1463

Ref: IN-DA000JQB