CymitQuimica logo

CAS 1228957-08-1

:

3-[1-[(1,1-Dimethylethyl)dimethylsilyl]-1H-indol-5-yl]benzoic acid

Description:
3-[1-[(1,1-Dimethylethyl)dimethylsilyl]-1H-indol-5-yl]benzoic acid is a chemical compound characterized by its complex structure, which includes an indole moiety and a benzoic acid functional group. The presence of a dimethylsilyl group contributes to its unique properties, potentially enhancing its stability and solubility in organic solvents. This compound may exhibit interesting biological activities due to the indole structure, which is known for its presence in various natural products and pharmaceuticals. The benzoic acid component suggests potential acidity and reactivity, particularly in forming salts or esters. Additionally, the bulky tert-butyl group may influence the steric hindrance and overall molecular interactions. As a result, this compound could be of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in different environments. Overall, its unique structural features position it as a potentially valuable compound in various chemical and biological contexts.
Formula:C21H25NO2Si
InChI:InChI=1S/C21H25NO2Si/c1-21(2,3)25(4,5)22-12-11-17-13-16(9-10-19(17)22)15-7-6-8-18(14-15)20(23)24/h6-14H,1-5H3,(H,23,24)
InChI key:InChIKey=HDBCXDRSFKQAAL-UHFFFAOYSA-N
SMILES:[Si](C(C)(C)C)(C)(C)N1C=2C(=CC(=CC2)C3=CC(C(O)=O)=CC=C3)C=C1
Synonyms:
  • Benzoic acid, 3-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-5-yl]-
  • 3-[1-[(1,1-Dimethylethyl)dimethylsilyl]-1H-indol-5-yl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.