CAS 1229-24-9
:6A-hydroxyestradiol
Description:
6A-Hydroxyestradiol is a synthetic derivative of estradiol, a key estrogen hormone involved in various physiological processes. This compound is characterized by the presence of a hydroxyl (-OH) group at the 6α position of the estradiol structure, which influences its biological activity and interaction with estrogen receptors. It exhibits estrogenic activity, meaning it can bind to estrogen receptors and elicit responses similar to those of natural estrogens. This compound is of interest in both pharmacological research and potential therapeutic applications, particularly in hormone replacement therapies and studies related to estrogen-related conditions. Additionally, 6A-hydroxyestradiol may play a role in the metabolism of estradiol and could be involved in the formation of other metabolites. Its chemical properties, such as solubility and stability, are influenced by the hydroxyl group, which can affect its bioavailability and pharmacokinetics. As with many steroid derivatives, understanding its characteristics is crucial for evaluating its potential effects and applications in medicine and biochemistry.
Formula:C18H24O3
InChI:InChI=1/C18H24O3/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(20)9-13(12)15(18)4-5-17(18)21/h2-3,8,12-13,15-17,19-21H,4-7,9H2,1H3/t12-,13-,15+,16+,17+,18+/m1/s1
Synonyms:- (6Alpha,17Beta)-Estra-1,3,5(10)-Triene-3,6,17-Triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6α-Hydroxyestradiol ((6S,8R,9S,13S,14S,17S)-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,6,17-triol)
CAS:Phenol-alcoholsFormula:C18H24O3Color and Shape:White Off-White SolidMolecular weight:288.172546a-Hydroxy 17b-Estradiol
CAS:Formula:C18H24O3Purity:95%Color and Shape:SolidMolecular weight:288.38146-α-Hydroxy Estradiol
CAS:Formula:C18H24O3Color and Shape:White To Off-White SolidMolecular weight:288.396α-Hydroxyestradiol
CAS:Controlled ProductFormula:C18H24O3Color and Shape:NeatMolecular weight:288.386α-Hydroxy 17β-Estradiol
CAS:Controlled ProductFormula:C18H24O3Color and Shape:NeatMolecular weight:288.38






