CAS 1229-69-2
:4-Piperidinamine, 1-methyl-N-phenyl-N-(phenylmethyl)-, hydrochloride (1:1)
Description:
4-Piperidinamine, 1-methyl-N-phenyl-N-(phenylmethyl)-, hydrochloride (1:1), with the CAS number 1229-69-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl group and two phenyl substituents, contributing to its complex aromatic character. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The compound may exhibit various biological activities, including potential effects on the central nervous system, owing to the piperidine structure. Safety and handling precautions should be observed, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry contexts.
Formula:C19H24N2·ClH
InChI:InChI=1S/C19H24N2.ClH/c1-20-14-12-19(13-15-20)21(18-10-6-3-7-11-18)16-17-8-4-2-5-9-17;/h2-11,19H,12-16H2,1H3;1H
InChI key:InChIKey=OIKFTEUNPYSIGY-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C2CCN(C)CC2)C3=CC=CC=C3.Cl
Synonyms:- 4-Piperidinamine, 1-methyl-N-phenyl-N-(phenylmethyl)-, hydrochloride (1:1)
- 4-Piperidinamine, 1-methyl-N-phenyl-N-(phenylmethyl)-, monohydrochloride
- Piperidine, 4-(N-benzylanilino)-1-methyl-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
