CAS 122914-94-7
:(3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone
Description:
(3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone, identified by its CAS number 122914-94-7, is a synthetic derivative of androstene, a steroid framework. This compound features a hydrazone functional group, which is formed by the reaction of a hydrazine with a carbonyl compound, in this case, the ketone at the 17 position of the steroid structure. The presence of the acetyloxy group at the 3β position enhances its lipophilicity and may influence its biological activity. The structural modifications impart unique characteristics, potentially affecting its interaction with biological targets, such as steroid receptors. This compound may exhibit various pharmacological properties, including potential anti-inflammatory or anticancer activities, although specific biological effects would depend on further empirical studies. Its synthesis and characterization involve standard organic chemistry techniques, and it may serve as a valuable intermediate in the development of steroid-based pharmaceuticals. As with many steroid derivatives, it is essential to consider its stability, solubility, and reactivity in various conditions for practical applications.
Formula:C21H32N2O2
InChI:InChI=1S/C21H32N2O2/c1-13(24)25-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23-22)21(17,3)11-9-18(16)20/h4,15-18H,5-12,22H2,1-3H3/t15-,16-,17-,18-,20-,21-/m0/s1
InChI key:InChIKey=AVVTXAOOIGIGOW-ZKHIMWLXSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)C(=NN)CC4)[H])(CC=C1C[C@@H](OC(C)=O)CC2)[H])[H]
Synonyms:- Androst-5-en-17-one, 3-(acetyloxy)-, 17-hydrazone, (3β)-
- Dehydroepiandrosterone hydrazone
- (3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Depyridinyl Abiraterone 3-Acetate 17-Hydrazone
CAS:Controlled ProductFormula:C21H32N2O2Color and Shape:NeatMolecular weight:344.49Depyridinyl Abiraterone 3-Acetate 17-Hydrazone (1 mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C21H32N2O2Color and Shape:Single SolutionMolecular weight:344.493-o-Acetylandrostenone hydrazone
CAS:Controlled Product3-o-Acetylandrostenone hydrazone is a chemical compound categorized as a steroid derivative, which is synthesized through chemical modification processes. This compound is typically derived from androstenone, a pheromone naturally found in male mammals, known for its role in communication and reproductive behaviors. Its mode of action involves interacting with olfactory receptors, providing insights into its volatile nature and potential pheromonal activity.Formula:C21H32N2O2Purity:Min. 95%Molecular weight:344.5 g/mol


