CAS 122914-94-7

(3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone

Description:

(3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone, identified by its CAS number 122914-94-7, is a synthetic derivative of androstene, a steroid framework. This compound features a hydrazone functional group, which is formed by the reaction of a hydrazine with a carbonyl compound, in this case, the ketone at the 17 position of the steroid structure. The presence of the acetyloxy group at the 3β position enhances its lipophilicity and may influence its biological activity. The structural modifications impart unique characteristics, potentially affecting its interaction with biological targets, such as steroid receptors. This compound may exhibit various pharmacological properties, including potential anti-inflammatory or anticancer activities, although specific biological effects would depend on further empirical studies. Its synthesis and characterization involve standard organic chemistry techniques, and it may serve as a valuable intermediate in the development of steroid-based pharmaceuticals. As with many steroid derivatives, it is essential to consider its stability, solubility, and reactivity in various conditions for practical applications.

Formula: C₂₁H₃₂N₂O₂

InChI: InChI=1S/C21H32N2O2/c1-13(24)25-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23-22)21(17,3)11-9-18(16)20/h4,15-18H,5-12,22H2,1-3H3/t15-,16-,17-,18-,20-,21-/m0/s1

InChI key: InChIKey=AVVTXAOOIGIGOW-ZKHIMWLXSA-N

SMILES: C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)C(=NN)CC4)[H])(CC=C1C[C@@H](OC(C)=O)CC2)[H])[H]

Synonyms:

• Androst-5-en-17-one, 3-(acetyloxy)-, 17-hydrazone, (3β)-
• Dehydroepiandrosterone hydrazone
• (3β)-3-(Acetyloxy)androst-5-en-17-one 17-hydrazone

Depyridinyl Abiraterone 3-Acetate 17-Hydrazone

Controlled Product

CAS: 122914-94-7

Formula: C₂₁H₃₂N₂O₂

Color and Shape: Neat

Molecular weight: 344.49

Ref: TR-D288080

Depyridinyl Abiraterone 3-Acetate 17-Hydrazone (1 mg/ml in Acetonitrile)

Controlled Product

CAS: 122914-94-7

Formula: C₂₁H₃₂N₂O₂

Color and Shape: Single Solution

Molecular weight: 344.49

Ref: TR-KIT4000

3-o-Acetylandrostenone hydrazone

Controlled Product

CAS: 122914-94-7

3-o-Acetylandrostenone hydrazone is a chemical compound categorized as a steroid derivative, which is synthesized through chemical modification processes. This compound is typically derived from androstenone, a pheromone naturally found in male mammals, known for its role in communication and reproductive behaviors. Its mode of action involves interacting with olfactory receptors, providing insights into its volatile nature and potential pheromonal activity.

Formula: C₂₁H₃₂N₂O₂

Purity: Min. 95%

Molecular weight: 344.5 g/mol

Ref: 3D-XEA91494

3-O-Acetylandrostenone Hydrazone

CAS: 122914-94-7

Formula: C₂₁H₃₂N₂O₂

Molecular weight: 344.5

Ref: ST-EA-CP-A67030