CAS 122923-02-8

1,5-Epoxynaphthalene-1(4H)-methanol, 4a,5,6,7,8,8a-hexahydro-6,8-bis(methoxymethoxy)-α,7-dimethyl-α-1-propynyl-, [1α,1(S*),4aβ,5α,6β,7β,8α,8aβ]-

Description:

1,5-Epoxynaphthalene-1(4H)-methanol, with the CAS number 122923-02-8, is a complex organic compound characterized by its unique structural features, including an epoxide group and multiple methoxy substituents. This compound belongs to a class of naphthalene derivatives, which are known for their aromatic properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the epoxide functional group suggests that it may exhibit reactivity typical of epoxides, such as undergoing ring-opening reactions under certain conditions. Additionally, the methoxy groups can influence the compound's solubility and reactivity, making it potentially useful in organic synthesis. The stereochemistry indicated by the detailed nomenclature suggests that the compound may exhibit specific spatial arrangements that could affect its biological activity or interaction with other molecules. Overall, this compound's intricate structure and functional groups contribute to its potential utility in chemical research and applications.

Formula: C₂₀H₃₀O₆

InChI: InChI=1S/C20H30O6/c1-6-9-19(3,21)20-10-7-8-14-15(20)16(24-11-22-4)13(2)17(18(14)26-20)25-12-23-5/h7,10,13-18,21H,8,11-12H2,1-5H3

InChI key: InChIKey=PLWVKTCERWWFQZ-UHFFFAOYSA-N

SMILES: C(C#CC)(C)(O)C12C3C(C(O1)C(OCOC)C(C)C3OCOC)CC=C2

Synonyms:

• 1,5-Epoxynaphthalene-1(4H)-methanol, 4a,5,6,7,8,8a-hexahydro-6,8-bis(methoxymethoxy)-α,7-dimethyl-α-1-propynyl-, [1α,1(S*),4aβ,5α,6β,7β,8α,8aβ]-

1,5-Epoxynaphthalene-1(4H)-methanol, 4a,5,6,7,8,8a-hexahydro-6,8-bis(methoxymethoxy)-α,7-dimethyl-α-1-propynyl-, [1α,1(S*),4aβ,5α,6β,7β,8α,8aβ]- (9CI)

CAS: 122923-02-8

Formula: C₂₀H₃₀O₆

Molecular weight: 366.4486

Ref: IN-DA000JSP