CAS 1229236-86-5: Gandotinib
Description:Gandotinib is a small molecule inhibitor primarily designed to target specific kinases involved in cancer cell proliferation and survival. It is classified as a potent and selective inhibitor of the receptor tyrosine kinase, particularly focusing on the c-Met pathway, which plays a crucial role in various malignancies. The compound exhibits characteristics typical of kinase inhibitors, including the ability to disrupt signaling pathways that promote tumor growth and metastasis. Gandotinib's chemical structure includes functional groups that enhance its binding affinity to the target kinase, contributing to its efficacy in preclinical studies. It has been investigated for its potential therapeutic applications in treating various types of cancer, particularly those with aberrant c-Met signaling. As with many investigational drugs, its pharmacokinetics, safety profile, and effectiveness are subjects of ongoing research, with the aim of determining optimal dosing regimens and potential combination therapies. Overall, Gandotinib represents a promising avenue in targeted cancer therapy, reflecting the broader trend of developing selective agents to improve treatment outcomes.
Formula:C23H25ClFN7O
InChI:InChI=1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30)
InChI key:InChIKey=SQSZANZGUXWJEA-UHFFFAOYSA-N
SMILES:FC1=CC(Cl)=CC=C1CC2=C(N=C3C(=CC(=NN32)NC4=NNC(=C4)C)CN5CCOCC5)C