CAS 122929-08-2
:corazonin
Description:
Corazonin is a neuropeptide that plays a significant role in the physiological processes of various invertebrates, particularly in the regulation of behavior and stress responses. It is characterized by its structure as a peptide composed of a specific sequence of amino acids, which contributes to its biological activity. Corazonin is known to influence heart rate, metabolic processes, and may also be involved in the modulation of reproductive behaviors. The substance is typically found in the nervous systems of insects and other arthropods, where it acts as a signaling molecule. Its effects are mediated through specific receptors, leading to various physiological responses. Corazonin's role in the endocrine system highlights its importance in the study of neuropeptides and their functions in invertebrate biology. Research into corazonin continues to provide insights into the complex interactions between neuropeptides and their target systems, enhancing our understanding of invertebrate physiology and potential applications in biotechnology and pest management.
Formula:C62H84N18O18
InChI:InChI=1/C62H84N18O18/c1-30(82)50(60(97)75-41(52(65)89)26-47(64)86)80-58(95)44(25-34-27-69-37-12-7-6-11-36(34)37)72-49(88)28-70-53(90)38(13-8-22-68-62(66)67)73-59(96)45(29-81)78-57(94)42(24-33-14-16-35(84)17-15-33)76-54(91)40(18-20-46(63)85)74-56(93)43(23-32-9-4-3-5-10-32)77-61(98)51(31(2)83)79-55(92)39-19-21-48(87)71-39/h3-7,9-12,14-17,27,30-31,38-45,50-51,69,81-84H,8,13,18-26,28-29H2,1-2H3,(H2,63,85)(H2,64,86)(H2,65,89)(H,70,90)(H,71,87)(H,72,88)(H,73,96)(H,74,93)(H,75,97)(H,76,91)(H,77,98)(H,78,94)(H,79,92)(H,80,95)(H4,66,67,68)
SMILES:CC(C(C(=NC(CC(=N)O)C(=N)O)O)N=C(C(Cc1c[nH]c2ccccc12)N=C(CN=C(C(CCCNC(=N)N)N=C(C(CO)N=C(C(Cc1ccc(cc1)O)N=C(C(CCC(=N)O)N=C(C(Cc1ccccc1)N=C(C(C(C)O)N=C(C1CCC(=N1)O)O)O)O)O)O)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Oxo-L-prolyl-L-threonyl-L-phenylalanyl-L-glutaminyl-L-tyrosyl-L-seryl-L-arginylglycyl-L-tryptophyl-L-threonyl-L-aspartamide
CAS:Formula:C62H84N18O18Purity:97%Color and Shape:SolidMolecular weight:1369.4402Corazonin
CAS:Corazonin, a neuropeptide in insects, regulates caste identity and behavior, mainly in workers/foragers.Formula:C62H83N17O19Color and Shape:SolidMolecular weight:1370.42Corazonin Pyr-Thr-Phe-Gln-Tyr-Ser-Arg-Gly-Trp-Thr-Asn-NH2
CAS:Corazonin is a peptide hormone that regulates the transcription of genes in the hypothalamus and other areas of the brain. It has been shown to increase metabolic rate, locomotor activity, and physiological function. Corazonin also regulates neurotransmission by binding to neurosecretory receptors in the brain. The effects of corazonin may be mediated through its ability to induce cAMP production and inhibit fatty acid synthesis. It has been shown to regulate energy metabolism and promote neurogenesis in animals.Formula:C62H84N18O18Purity:Min. 95%Molecular weight:1,369.44 g/mol


