CAS 1229516-73-7
:1-(4-Piperidinyl)-1H-1,2,3-triazole-4-methanamine
Description:
1-(4-Piperidinyl)-1H-1,2,3-triazole-4-methanamine, with the CAS number 1229516-73-7, is a chemical compound characterized by its unique structural features, which include a triazole ring and a piperidine moiety. This compound typically exhibits properties such as being a solid at room temperature and may have moderate solubility in polar solvents due to the presence of both nitrogen-containing heterocycles and amine functional groups. The triazole ring contributes to its potential biological activity, as triazoles are known for their role in pharmaceuticals, particularly as antifungal agents and in other therapeutic applications. The piperidine group may enhance its interaction with biological targets, potentially influencing its pharmacokinetic properties. Additionally, the compound's reactivity can be attributed to the presence of the amine group, which may participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry and drug development.
Formula:C8H15N5
InChI:InChI=1S/C8H15N5/c9-5-7-6-13(12-11-7)8-1-3-10-4-2-8/h6,8,10H,1-5,9H2
InChI key:InChIKey=ACNLAVAXIHNEDA-UHFFFAOYSA-N
SMILES:C(N)C1=CN(N=N1)C2CCNCC2
Synonyms:- 1H-1,2,3-Triazole-4-methanamine, 1-(4-piperidinyl)-
- 1-(4-Piperidinyl)-1H-1,2,3-triazole-4-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.