CymitQuimica logo

CAS 1229516-76-0

:

Methyl 1-(4-piperidinyl)-1H-1,2,3-triazole-4-carboxylate

Description:
Methyl 1-(4-piperidinyl)-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a piperidine moiety, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. Its methyl ester form suggests it may exhibit different solubility and reactivity profiles compared to its carboxylic acid counterpart. The compound's structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the triazole ring is known for its role in various pharmacological applications, including antifungal and anticancer activities. Overall, Methyl 1-(4-piperidinyl)-1H-1,2,3-triazole-4-carboxylate is a versatile compound with potential applications in pharmaceuticals and research.
Formula:C9H14N4O2
InChI:InChI=1S/C9H14N4O2/c1-15-9(14)8-6-13(12-11-8)7-2-4-10-5-3-7/h6-7,10H,2-5H2,1H3
InChI key:InChIKey=LQYNVCZMQHCIOA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CN(N=N1)C2CCNCC2
Synonyms:
  • Methyl 1-(4-piperidinyl)-1H-1,2,3-triazole-4-carboxylate
  • 1H-1,2,3-Triazole-4-carboxylic acid, 1-(4-piperidinyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.