CymitQuimica logo

CAS 1229608-68-7

:

1-[4-Bromo-2-(methoxymethyl)phenyl]-2-ethylpiperidine

Description:
1-[4-Bromo-2-(methoxymethyl)phenyl]-2-ethylpiperidine is a chemical compound characterized by its complex structure, which includes a piperidine ring and a substituted phenyl group. The presence of a bromine atom and a methoxymethyl group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an organic amine due to the piperidine moiety, which can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. The compound's solubility, stability, and interaction with biological systems would depend on its functional groups and overall polarity. As with many organic compounds, safety and handling precautions are essential, especially considering the presence of bromine, which can pose health risks. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and materials science.
Formula:C15H22BrNO
InChI:InChI=1S/C15H22BrNO/c1-3-14-6-4-5-9-17(14)15-8-7-13(16)10-12(15)11-18-2/h7-8,10,14H,3-6,9,11H2,1-2H3
InChI key:InChIKey=MGISGIKXPFMSGQ-UHFFFAOYSA-N
SMILES:C(OC)C1=C(C=CC(Br)=C1)N2C(CC)CCCC2
Synonyms:
  • Piperidine, 1-[4-bromo-2-(methoxymethyl)phenyl]-2-ethyl-
  • 1-[4-Bromo-2-(methoxymethyl)phenyl]-2-ethylpiperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.