
CAS 1229620-82-9: 1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, 1-acetate, hydrochloride (1:1), (6S)-
Description:1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, 1-acetate, hydrochloride (1:1), (6S)- is a complex organic compound characterized by its naphthalene structure, which is a fused bicyclic aromatic hydrocarbon. The presence of a tetrahydro group indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system. The compound features a propyl group and a thienyl moiety, suggesting potential interactions with biological systems, particularly in pharmacological contexts. The acetate group indicates that it is an ester, which can influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability. The (6S) designation refers to its stereochemistry, indicating a specific three-dimensional arrangement of atoms that can significantly affect its biological activity. Overall, this compound may exhibit interesting properties and potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation.
Formula:C21H27NO2S·ClH
InChI:InChI=1S/C21H27NO2S.ClH/c1-3-12-22(13-11-19-7-5-14-25-19)18-9-10-20-17(15-18)6-4-8-21(20)24-16(2)23;/h4-8,14,18H,3,9-13,15H2,1-2H3;1H/t18-;/m0./s1
InChI key:InChIKey=AVIUYGPHELTUQP-FERBBOLQSA-N
SMILES:Cl.O=C(OC1=CC=CC2=C1CCC(N(CCC=3SC=CC3)CCC)C2)C
- Synonyms:
- O-Acetylrotigotine hydrochloride
- 1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, 1-acetate, hydrochloride (1:1), (6S)-
- (6S)-(-)-5,6,7,8-Tetrahydro-6-[propyl(2-thienylethyl)]amino]-1-naphthol hydrochloride

Acetyl Rotigotine Hydrochloride ((S)-6-(propyl(2-(thiophen-2-yl)ethyl)amino)-5,6,7,8-tetrahydronaphthalen-1-yl acetate hydrochloride)
Ref: 45-1A06460
25mg | 1,554.00 € |

Rotigotine Impurity 7
Ref: 3D-IO181652
Undefined size | To inquire |

O-Acetylrotigotine Hydrochloride
Controlled ProductRef: TR-A233170
25mg | 1,568.00 € |