CAS 1229623-49-7

Methyl 2,3-dihydro-1-(methylsulfonyl)-β-oxo-1H-indole-5-propanoate

Description:

Methyl 2,3-dihydro-1-(methylsulfonyl)-β-oxo-1H-indole-5-propanoate, with the CAS number 1229623-49-7, is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methylsulfonyl group, which enhances its solubility and reactivity, and a β-oxo group that contributes to its potential as a precursor in various chemical reactions. The presence of the propanoate moiety indicates that it can participate in esterification reactions. Methyl 2,3-dihydro-1-(methylsulfonyl)-β-oxo-1H-indole-5-propanoate may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many indole derivatives, it may also possess interesting properties related to fluorescence or photochemical behavior, which could be explored in various scientific studies.

Formula: C₁₃H₁₅NO₅S

InChI: InChI=1S/C13H15NO5S/c1-19-13(16)8-12(15)10-3-4-11-9(7-10)5-6-14(11)20(2,17)18/h3-4,7H,5-6,8H2,1-2H3

InChI key: InChIKey=MGUGGAHECGBPPH-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)N1C=2C(=CC(C(CC(OC)=O)=O)=CC2)CC1

Synonyms:

• 1H-Indole-5-propanoic acid, 2,3-dihydro-1-(methylsulfonyl)-β-oxo-, methyl ester
• Methyl 2,3-dihydro-1-(methylsulfonyl)-β-oxo-1H-indole-5-propanoate