
CAS 1229623-59-9
:2-Morpholinecarboxamide, N-cyclopentyl-, hydrochloride (1:1)
Description:
2-Morpholinecarboxamide, N-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its morpholine ring structure, which contributes to its potential as a pharmacological agent. The presence of the cyclopentyl group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various formulations. This compound may exhibit properties such as moderate to high stability under standard conditions, and its amide functional group suggests potential for hydrogen bonding, impacting its solubility and reactivity. The compound's specific applications and biological activity would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. Safety and handling considerations should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C10H18N2O2·ClH
InChI:InChI=1S/C10H18N2O2.ClH/c13-10(9-7-11-5-6-14-9)12-8-3-1-2-4-8;/h8-9,11H,1-7H2,(H,12,13);1H
InChI key:InChIKey=ZDBSTSJKGIVRJG-UHFFFAOYSA-N
SMILES:C(NC1CCCC1)(=O)C2CNCCO2.Cl
Synonyms:- 2-Morpholinecarboxamide, N-cyclopentyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.