CAS 1229623-68-0

Methyl 1-(2-methoxyphenyl)-β,5-dioxo-3-pyrrolidinepropanoate

Description:

Methyl 1-(2-methoxyphenyl)-β,5-dioxo-3-pyrrolidinepropanoate, identified by its CAS number 1229623-68-0, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a methoxyphenyl group, contributing to its aromatic properties, and a β,5-dioxo functional group, indicating the presence of two carbonyl groups within the structure. The methyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding acid. The molecular structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrrolidine and aromatic moieties, which are often associated with bioactive compounds. Additionally, the compound's solubility and reactivity may be influenced by the methoxy group, which can affect its interaction with biological targets. Overall, this compound represents a complex organic structure with potential significance in various chemical and biological contexts.

Formula: C₁₅H₁₇NO₅

InChI: InChI=1S/C15H17NO5/c1-20-13-6-4-3-5-11(13)16-9-10(7-14(16)18)12(17)8-15(19)21-2/h3-6,10H,7-9H2,1-2H3

InChI key: InChIKey=FTMCSNOLJDRTAV-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(CC(OC)=O)=O)C1)C2=C(OC)C=CC=C2

Synonyms:

• Methyl 1-(2-methoxyphenyl)-β,5-dioxo-3-pyrrolidinepropanoate
• 3-Pyrrolidinepropanoic acid, 1-(2-methoxyphenyl)-β,5-dioxo-, methyl ester