
CAS 1229625-45-9
:4(3H)-Pyrimidinone, 2-methyl-6-(2-piperidinyl)-, hydrochloride (1:2)
Description:
4(3H)-Pyrimidinone, 2-methyl-6-(2-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidinone core structure, which features a methyl group at the 2-position and a piperidine substituent at the 6-position. This compound is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form, which enhances its solubility in polar solvents like water. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. The compound's molecular structure suggests it may interact with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1229625-45-9, allows for precise identification in chemical databases. Overall, this substance may exhibit unique chemical reactivity and biological interactions, warranting further investigation for potential applications in drug development or other fields of research.
Formula:C10H15N3O·2ClH
InChI:InChI=1S/C10H15N3O.2ClH/c1-7-12-9(6-10(14)13-7)8-4-2-3-5-11-8;;/h6,8,11H,2-5H2,1H3,(H,12,13,14);2*1H
InChI key:InChIKey=JTFFDTNCTMTMRZ-UHFFFAOYSA-N
SMILES:O=C1C=C(NC(C)=N1)C2CCCCN2.Cl
Synonyms:- 4(3H)-Pyrimidinone, 2-methyl-6-(2-piperidinyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.