
CAS 1229627-11-5
:4-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:1)
Description:
4-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This substance features a cyclohexyl and a methyl group attached to the nitrogen atom of the piperidine, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and chemical research. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the compound may exhibit basic properties due to the amine, which can affect its behavior in different pH environments. Overall, its structural characteristics suggest potential utility in medicinal chemistry, particularly in the development of compounds targeting neurological or psychiatric conditions. However, specific safety and handling guidelines should be followed due to its chemical nature.
Formula:C12H24N2·ClH
InChI:InChI=1S/C12H24N2.ClH/c1-14(11-5-3-2-4-6-11)12-7-9-13-10-8-12;/h11-13H,2-10H2,1H3;1H
InChI key:InChIKey=NPXOLJIQXDGLLB-UHFFFAOYSA-N
SMILES:N(C)(C1CCCCC1)C2CCNCC2.Cl
Synonyms:- 4-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.