
CAS 1229627-20-6
:4-[6-(Dimethylamino)-2-(4-piperidinyl)-4-pyrimidinyl]-1-(phenylmethyl)-2-pyrrolidinone
Description:
4-[6-(Dimethylamino)-2-(4-piperidinyl)-4-pyrimidinyl]-1-(phenylmethyl)-2-pyrrolidinone, identified by its CAS number 1229627-20-6, is a synthetic organic compound that belongs to a class of molecules known for their potential pharmacological properties. This compound features a complex structure characterized by a pyrrolidinone core, which is substituted with various functional groups, including a dimethylamino group and a piperidinyl moiety. These structural elements suggest that it may interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. The presence of the phenylmethyl group indicates possible lipophilicity, which can affect its bioavailability and distribution in biological systems. While specific data on its solubility, melting point, or stability may vary, compounds of this nature are often explored for their therapeutic applications, particularly in the fields of neurology or psychiatry. Further research is necessary to fully elucidate its pharmacodynamics, pharmacokinetics, and safety profile.
Formula:C22H29N5O
InChI:InChI=1S/C22H29N5O/c1-26(2)20-13-19(24-22(25-20)17-8-10-23-11-9-17)18-12-21(28)27(15-18)14-16-6-4-3-5-7-16/h3-7,13,17-18,23H,8-12,14-15H2,1-2H3
InChI key:InChIKey=IVACHXWDVWAIFL-UHFFFAOYSA-N
SMILES:N(C)(C)C1=CC(=NC(=N1)C2CCNCC2)C3CN(CC4=CC=CC=C4)C(=O)C3
Synonyms:- 4-[6-(Dimethylamino)-2-(4-piperidinyl)-4-pyrimidinyl]-1-(phenylmethyl)-2-pyrrolidinone
- 2-Pyrrolidinone, 4-[6-(dimethylamino)-2-(4-piperidinyl)-4-pyrimidinyl]-1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.