CAS 1229652-22-5
:B-[4-[[4-[[3-[(4-Fluorophenyl)methyl]-2,4-dioxo-5-thiazolidinylidene]methyl]phenoxy]methyl]phenyl]boronic acid
Description:
B-[4-[[4-[[3-[(4-Fluorophenyl)methyl]-2,4-dioxo-5-thiazolidinylidene]methyl]phenoxy]methyl]phenyl]boronic acid, identified by its CAS number 1229652-22-5, is a boronic acid derivative characterized by its complex molecular structure that includes a boron atom bonded to a phenyl group and a thiazolidinone moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the fluorophenyl group may enhance its biological activity or solubility. Additionally, the thiazolidinone structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and reactivity are influenced by the functional groups present, which can affect its stability and interaction with other molecules. Overall, this compound represents a unique class of boronic acids with potential utility in pharmaceutical and chemical research.
Formula:C24H19BFNO5S
InChI:InChI=1S/C24H19BFNO5S/c26-20-9-3-17(4-10-20)14-27-23(28)22(33-24(27)29)13-16-5-11-21(12-6-16)32-15-18-1-7-19(8-2-18)25(30)31/h1-13,30-31H,14-15H2
InChI key:InChIKey=BRWUZCBSWABPMR-UHFFFAOYSA-N
SMILES:C(=C1C(=O)N(CC2=CC=C(F)C=C2)C(=O)S1)C3=CC=C(OCC4=CC=C(B(O)O)C=C4)C=C3
Synonyms:- HA 155
- Boronic acid, B-[4-[[4-[[3-[(4-fluorophenyl)methyl]-2,4-dioxo-5-thiazolidinylidene]methyl]phenoxy]methyl]phenyl]-
- B-[4-[[4-[[3-[(4-Fluorophenyl)methyl]-2,4-dioxo-5-thiazolidinylidene]methyl]phenoxy]methyl]phenyl]boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
HA 155
CAS:HA 155 (Autotaxin Inhibitor IV) is a boronic acid-based compound, inhibiting ATX with IC50 of 5.7 nM by selectively binding to its catalytic threonine.Formula:C24H19BFNO5SPurity:99.88%Color and Shape:SolidMolecular weight:463.29HA 155
CAS:HA 155 is a reactive polypeptide that can be used to treat influenza virus infection. It has been shown to inhibit the growth of viruses that are resistant to cross-linking agents. HA 155 binds to the viral hemagglutinin protein and inhibits the virus from attaching to cells, thereby preventing infection. This drug also has an extender effect on influenza vaccines and is used in some countries as a plant growth regulator.Formula:C24H19BFNO5SPurity:Min. 95%Molecular weight:463.3 g/mol


