CymitQuimica logo

CAS 122968-05-2

:

6,6-Dimethyl-1-methylene-4,8-dioxaspiro[2.5]octane

Description:
6,6-Dimethyl-1-methylene-4,8-dioxaspiro[2.5]octane is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with a dioxane moiety. This compound contains two methyl groups at the 6-position, contributing to its steric and electronic properties. The presence of a methylene group and the dioxaspiro configuration enhances its potential for various chemical reactivity and interactions. Typically, compounds of this nature may exhibit interesting physical properties such as volatility and solubility, influenced by their molecular structure. Additionally, the spirocyclic nature often imparts rigidity to the molecule, which can affect its conformational behavior and reactivity. While specific applications may vary, compounds with similar structures are often explored in fields such as organic synthesis, medicinal chemistry, and materials science due to their unique properties and potential biological activities. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C9H14O2
InChI:InChI=1S/C9H14O2/c1-7-4-9(7)10-5-8(2,3)6-11-9/h1,4-6H2,2-3H3
InChI key:InChIKey=UOLAJAULFPZUNA-UHFFFAOYSA-N
SMILES:C=C1C2(C1)OCC(C)(C)CO2
Synonyms:
  • 6,6-Dimethyl-1-methylene-4,8-dioxaspiro[2.5]octane
  • 4,8-Dioxaspiro[2.5]octane, 6,6-dimethyl-1-methylene-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.