CAS 1229705-32-1

3-Azetidinol, 3-(2H-tetrazol-5-yl)-, hydrochloride (1:1)

Description:

3-Azetidinol, 3-(2H-tetrazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the tetrazole moiety, a five-membered ring containing four nitrogen atoms, contributes to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions, including hydrogen bonding and potential receptor binding, are influenced by the functional groups present in its structure. The specific characteristics, such as melting point, solubility, and reactivity, would depend on the detailed molecular structure and the conditions under which it is studied. As with many compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₄H₇N₅O·ClH

InChI: InChI=1S/C4H7N5O.ClH/c10-4(1-5-2-4)3-6-8-9-7-3;/h5,10H,1-2H2,(H,6,7,8,9);1H

InChI key: InChIKey=WHYBZEQJKYPCST-UHFFFAOYSA-N

SMILES: OC1(CNC1)C=2NN=NN2.Cl

Synonyms:

• 3-Azetidinol, 3-(2H-tetrazol-5-yl)-, hydrochloride (1:1)

3-(1H-1,2,3,4-Tetrazol-5-yl)azetidin-3-ol hydrochloride

CAS: 1229705-32-1

Versatile small molecule scaffold

Formula: C₄H₈ClN₅O

Purity: Min. 95%

Molecular weight: 177.59 g/mol

Ref: 3D-EZB70532