CAS 122984-73-0
:corazonin
Description:
Corazonin is a neuropeptide that plays a significant role in the physiological processes of various invertebrates, particularly in insects. It is known for its involvement in regulating behaviors such as feeding, reproduction, and stress responses. Structurally, corazonin is characterized by a specific amino acid sequence, which contributes to its biological activity. The peptide is typically found in the nervous system and is released in response to certain stimuli, influencing various hormonal pathways. Corazonin has been studied for its potential implications in understanding insect physiology and behavior, as well as its potential applications in pest management. Its CAS number, 122984-73-0, uniquely identifies this compound in chemical databases, facilitating research and communication within the scientific community. Overall, corazonin exemplifies the complexity of neuropeptide signaling in invertebrates and highlights the intricate relationships between hormones and behavior in these organisms.
Formula:C62H84N18O18
InChI:InChI=1/C62H84N18O18/c1-30(82)50(60(97)75-41(52(65)89)26-47(64)86)80-58(95)44(25-34-27-69-37-12-7-6-11-36(34)37)72-49(88)28-70-53(90)38(13-8-22-68-62(66)67)73-59(96)45(29-81)78-57(94)42(24-33-14-16-35(84)17-15-33)76-54(91)40(18-20-46(63)85)74-56(93)43(23-32-9-4-3-5-10-32)77-61(98)51(31(2)83)79-55(92)39-19-21-48(87)71-39/h3-7,9-12,14-17,27,30-31,38-45,50-51,69,81-84H,8,13,18-26,28-29H2,1-2H3,(H2,63,85)(H2,64,86)(H2,65,89)(H,70,90)(H,71,87)(H,72,88)(H,73,96)(H,74,93)(H,75,97)(H,76,91)(H,77,98)(H,78,94)(H,79,92)(H,80,95)(H4,66,67,68)
SMILES:CC(C(C(=NC(CC(=N)O)C(=N)O)O)N=C(C(Cc1c[nH]c2ccccc12)N=C(CN=C(C(CCCNC(=N)N)N=C(C(CO)N=C(C(Cc1ccc(cc1)O)N=C(C(CCC(=N)O)N=C(C(Cc1ccccc1)N=C(C(C(C)O)N=C(C1CCC(=N1)O)O)O)O)O)O)O)O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.