CymitQuimica logo

CAS 122994-69-8

:

4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1,3-oxazole

Description:
4-(Chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1,3-oxazole, with the CAS number 122994-69-8, is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a methoxyphenyl group contributes to its aromatic character, influencing its solubility and interaction with other molecules. The methyl group on the oxazole ring can affect its electronic properties and steric hindrance. Generally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the chloromethyl group can serve as a leaving group in nucleophilic substitution reactions, further expanding its utility in synthetic organic chemistry. Overall, the unique combination of functional groups in this compound suggests potential applications in various chemical and pharmaceutical contexts.
Formula:C12H12ClNO2
InChI:InChI=1/C12H12ClNO2/c1-8-11(7-13)14-12(16-8)9-3-5-10(15-2)6-4-9/h3-6H,7H2,1-2H3
SMILES:Cc1c(CCl)nc(c2ccc(cc2)OC)o1
Synonyms:
  • Oxazole, 4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.