CAS 123-43-3
:Sulfoacetic acid
Description:
Sulfoacetic acid, also known as 2-sulfanylacetic acid or mercaptoacetic acid, is an organic compound characterized by the presence of both a carboxylic acid and a thiol functional group. Its molecular formula is C2H6O2S, and it features a sulfonic acid group, which imparts significant polarity and solubility in water. This compound is typically a colorless to pale yellow liquid with a pungent odor. Sulfoacetic acid is known for its applications in various fields, including as a reagent in organic synthesis, in the production of surfactants, and as an intermediate in the manufacture of pharmaceuticals and agrochemicals. It exhibits properties such as being hygroscopic and having a relatively low boiling point. Additionally, it can participate in various chemical reactions, including esterification and nucleophilic substitution, due to the reactivity of its functional groups. Safety precautions are necessary when handling sulfoacetic acid, as it can be corrosive and irritating to the skin and eyes.
Formula:C2H4O5S
InChI:InChI=1S/C2H4O5S/c3-2(4)1-8(5,6)7/h1H2,(H,3,4)(H,5,6,7)
InChI key:InChIKey=AGGIJOLULBJGTQ-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)C(O)=O
Synonyms:- 2-Sulfoacetic acid
- Acetic acid, 2-sulfo-
- Acetic acid, sulfo-
- Carboxymethylsulfonic acid
- Sulfoethanoic acid
- Sulphoacetic Acid
- Sulfoacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Sulfoacetic acid, 50% aqueous solution
CAS:<p>Sulfoacetic acid is a strong inorganic acid that can be used as an antimicrobial agent in vitro. It has been shown to inhibit the growth of bacteria and fungi by disrupting their cell walls, which are rich in fatty acids. Sulfoacetic acid can also be used for the extraction of picolinic acid from plant sources. The chemical stability of this compound makes it suitable for use in mammalian tissue, where it may react with proteolytic enzymes and stimulate antibody response to antigens. In addition, sulfoacetic acid has been shown to have phase transition temperature of -14°C, making it useful for cryopreservation.</p>Formula:C2H4O5SPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:140.12 g/mol


