CAS 123-57-9
:3,5-Dimethylmorpholine
Description:
3,5-Dimethylmorpholine is a heterocyclic organic compound characterized by a morpholine ring with two methyl groups attached at the 3 and 5 positions. It has a molecular formula of C7H15NO and features a nitrogen atom within its six-membered ring structure, which contributes to its basicity and potential as a nucleophile. This compound is typically a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in water and various organic solvents, making it versatile in chemical applications. 3,5-Dimethylmorpholine is often used as a solvent, a reagent in organic synthesis, and as a catalyst in polymerization processes. Its properties include a relatively low boiling point and moderate volatility, which can influence its handling and storage. Additionally, it is important to note that, like many amines, it can be irritating to the skin and eyes, necessitating appropriate safety precautions during use.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=MDKHWJFKHDRFFZ-UHFFFAOYSA-N
SMILES:CC1NC(C)COC1
Synonyms:- Morpholine, 3,5-Dimethyl-
- NSC 28666
- 3,5-Dimethylmorpholine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Morpholine, 3,5-dimethyl-
CAS:Formula:C6H13NOPurity:97%Color and Shape:LiquidMolecular weight:115.17353,5-Dimethylmorpholine
CAS:3,5-DimethylmorpholinePurity:98%Color and Shape:Colourless LiquidMolecular weight:115.17g/mol3,5-Dimethylmorpholine
CAS:3,5-Dimethylmorpholine is a chiral amide that has anticancer activity. It is a linker that can be used to form amide bonds between two molecules. 3,5-Dimethylmorpholine has been shown to have labile proton and cellular reactivity in vitro. The reaction selectivity of 3,5-dimethylmorpholine can be improved by using piperidine as the solvent. This compound exhibits anticancer activity against CDK4/6 (cyclin-dependent kinase 4/6) inhibitor-resistant cell lines. It also exhibits anticancerc activity in vitro against cells with high levels of cdk4/6 inhibition.
Formula:C6H13NOPurity:Min. 95%Molecular weight:115.17 g/mol



