CAS 123-85-3
:2-(2-HYDROXYETHOXY)ACETAMIDE
Description:
2-(2-Hydroxyethoxy)acetamide, with the CAS number 123-85-3, is an organic compound characterized by its amide functional group and the presence of a hydroxyethoxy substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, which enhances its utility in different applications. The presence of the hydroxyethoxy group contributes to its hydrophilicity, making it useful in formulations requiring moisture retention or as a surfactant. Additionally, 2-(2-hydroxyethoxy)acetamide may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its stability under normal conditions allows for its use in various chemical processes, although it should be handled with care due to potential reactivity with strong acids or bases. Overall, this compound's unique structure and properties make it a valuable substance in both industrial and research settings.
Formula:C4H9NO3
InChI:InChI=1/C4H9NO3/c5-4(7)3-8-2-1-6/h6H,1-3H2,(H2,5,7)
SMILES:C(COCC(=N)O)O
Synonyms:- (2-Hydroxyethoxy)acetamide
- 2-(2-Hydroxyethoxy)-Acetamid
- Acetamide, 2-(2-hydroxyethoxy)-
- O-(2-Hydroxyethyl)glycolamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
