CymitQuimica logo

CAS 1230100-98-7

:

1-Cyclohexyl-4-piperidineacetic acid

Description:
1-Cyclohexyl-4-piperidineacetic acid is a chemical compound characterized by its unique structure, which includes a cyclohexyl group and a piperidine ring. This compound typically exhibits properties associated with both amines and carboxylic acids due to the presence of the piperidine nitrogen and the carboxylic acid functional group. It is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit activity as a neurotransmitter modulator or in other therapeutic areas. The compound is likely to be a solid at room temperature, with solubility in polar solvents, reflecting the presence of the carboxylic acid group. Its molecular interactions may involve hydrogen bonding, which can influence its biological activity and solubility. Safety data sheets would provide information on handling and toxicity, which is crucial for laboratory work. Overall, 1-Cyclohexyl-4-piperidineacetic acid represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C13H23NO2
InChI:InChI=1S/C13H23NO2/c15-13(16)10-11-6-8-14(9-7-11)12-4-2-1-3-5-12/h11-12H,1-10H2,(H,15,16)
InChI key:InChIKey=VBBMBKQSOWAEPV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1CCN(CC1)C2CCCCC2
Synonyms:
  • 1-Cyclohexyl-4-piperidineacetic acid
  • 4-Piperidineacetic acid, 1-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.