CymitQuimica logo

CAS 123027-99-6

:

2'-Bromo-5'-methoxyacetanilide

Description:
2'-Bromo-5'-methoxyacetanilide is an organic compound characterized by its structural features, which include a bromine atom and a methoxy group attached to an acetanilide framework. This compound typically exhibits a white to off-white crystalline appearance. The presence of the bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group contributes to the compound's solubility in organic solvents and can affect its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the acetanilide moiety suggests that this compound may exhibit biological activity, as many derivatives of acetanilide are known for their analgesic and antipyretic properties. Its specific applications may vary, but it is often utilized in synthetic organic chemistry and medicinal chemistry research. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with brominated compounds.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-6(12)11-9-5-7(13-2)3-4-8(9)10/h3-5H,1-2H3,(H,11,12)
InChI key:LQVIAWMRGFIPFM-UHFFFAOYSA-N
SMILES:CC(=O)NC1=C(C=CC(=C1)OC)Br
Found 4 products.