CAS 123039-93-0
:DIHYDREXIDINE HYDROCHLORIDE
Description:
Dihydrexidine hydrochloride is a synthetic compound primarily known for its role as a selective dopamine D1 receptor agonist. It is characterized by its ability to stimulate dopamine receptors, which plays a crucial role in various neurological processes. This compound is often studied in the context of neuropharmacology and has potential implications for understanding and treating conditions related to dopamine dysregulation, such as Parkinson's disease and schizophrenia. Dihydrexidine hydrochloride is typically presented as a white to off-white crystalline powder and is soluble in water, making it suitable for various formulations in research settings. Its pharmacological profile indicates that it may have effects on mood, cognition, and motor control, although further research is necessary to fully elucidate its therapeutic potential and safety profile. As with many compounds that interact with neurotransmitter systems, careful consideration of dosage and administration is essential to mitigate potential side effects.
Formula:C17H18ClNO2
InChI:InChI=1/C17H17NO2.ClH/c19-15-7-10-5-6-14-17(13(10)8-16(15)20)12-4-2-1-3-11(12)9-18-14;/h1-4,7-8,14,17-20H,5-6,9H2;1H/t14-,17-;/m1./s1
SMILES:c1ccc2c(c1)CN[C@@H]1CCc3cc(c(cc3[C@@H]21)O)O.Cl
Synonyms:- (+/-)-Trans-10,11-Dihydroxy-5,6,6A,7,8,12B-Hexahydrobenzo[A]Phenanthridine Hydrochloride
- DihydrexidineHCl
- Dihydroxidine Hydrochloride
- 5,6,6A,7,8,12B-Hexahydrobenzo[A]Phenanthridine-10,11-Diol
- (6aR,12bS)-10,11-dihydroxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzo[a]phenanthridine-10,11-diol, 5,6,6a,7,8,12b-hexahydro-, (6aR,12bS)-rel-
CAS:Formula:C17H17NO2Color and Shape:SolidMolecular weight:267.3224Dihydrexidine
CAS:Dihydrexidine is a full efficacy D1-like dopamine receptor (D1/D5) agonist (IC50: 10 nM for D1 receptor). It also shows potent antiparkinsonian activity.Formula:C17H17NO2Purity:98%Color and Shape:SolidMolecular weight:267.32Dihydrexidine
CAS:Dihydrexidine is a selective dopamine receptor agonist, which is synthesized in a laboratory setting. It primarily acts on D1-like dopamine receptors, facilitating an increase in dopaminergic signaling pathways. This increased signaling is achieved through binding and activating specific receptor subtypes that influence numerous neural pathways.
Formula:C17H17NO2Purity:Min. 95%Molecular weight:267.32 g/molRef: 3D-YEA03993
Discontinued product


