
CAS 123040-50-6
:6-Chloro-3,4-dihydro-4-methyl-3-oxo-2H-1,4-benzoxazine-8-carbonyl chloride
Description:
6-Chloro-3,4-dihydro-4-methyl-3-oxo-2H-1,4-benzoxazine-8-carbonyl chloride, with the CAS number 123040-50-6, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a benzoxazine moiety. This compound features a chloro substituent and a carbonyl chloride functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl group indicates that it may participate in nucleophilic reactions, while the chloro group can serve as a leaving group in various chemical transformations. The bicyclic structure often imparts unique physical and chemical properties, such as solubility in organic solvents and potential biological activity. Additionally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific safety and handling precautions should be observed due to the presence of reactive functional groups. Overall, this compound represents a versatile building block for further chemical modifications and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H7Cl2NO3
InChI:InChI=1S/C10H7Cl2NO3/c1-13-7-3-5(11)2-6(10(12)15)9(7)16-4-8(13)14/h2-3H,4H2,1H3
InChI key:InChIKey=MVKAERBIXRCENX-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C2C(N(C)C(=O)CO2)=CC(Cl)=C1
Synonyms:- 2H-1,4-Benzoxazine-8-carbonyl chloride, 6-chloro-3,4-dihydro-4-methyl-3-oxo-
- 6-Chloro-3,4-dihydro-4-methyl-3-oxo-2H-1,4-benzoxazine-8-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1,4-Benzoxazine-8-carbonyl chloride, 6-chloro-3,4-dihydro-4-methyl-3-oxo-
CAS:Formula:C10H7Cl2NO3Molecular weight:260.0735
