CAS 123061-49-4
:2-(METHYLTHIO)-4-(TRIBUTYLSTANNYL)PYRIMIDINE
Description:
2-(Methylthio)-4-(tributylstannyl)pyrimidine is an organometallic compound characterized by the presence of a pyrimidine ring substituted with both a methylthio group and a tributylstannyl group. The methylthio group (-S-CH3) introduces sulfur into the molecular structure, which can enhance the compound's reactivity and solubility in organic solvents. The tributylstannyl group, consisting of three butyl groups attached to a tin atom, contributes to the compound's organotin characteristics, often imparting unique properties such as increased lipophilicity and potential applications in organic synthesis and materials science. This compound may exhibit interesting biological activities due to the presence of the pyrimidine moiety, which is a common scaffold in pharmaceuticals. Additionally, the organotin component can influence the compound's stability and reactivity, making it a subject of interest in various chemical research fields, including catalysis and polymer chemistry. Safety considerations are important when handling organotin compounds due to their potential toxicity and environmental impact.
Formula:C17H32N2SSn
InChI:InChI=1/C5H5N2S.3C4H9.Sn/c1-8-5-6-3-2-4-7-5;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3;/rC17H32N2SSn/c1-5-8-13-21(14-9-6-2,15-10-7-3)16-11-12-18-17(19-16)20-4/h11-12H,5-10,13-15H2,1-4H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1ccnc(n1)SC
Synonyms:- 4-Tributylstannyl-2-Thiomethylpyrimidine
- 2-(Methylsulfanyl)-4-(Tributylstannanyl)Pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Methylthio)-4-(tributylstannyl)pyrimidine
CAS:Formula:C17H32N2SSnColor and Shape:LiquidMolecular weight:415.21542-(Methylthio)-4-(tributylstannyl)pyrimidine
CAS:2-(Methylthio)-4-(tributylstannyl)pyrimidinePurity:≥95%Molecular weight:415.22g/mol2-Methylthio-4-(tributylstannyl)pyrimidine
CAS:Controlled Product2-Methylthio-4-(tributylstannyl)pyrimidine is a synthetic heterocyclic compound that has been shown to be an inhibitor of bacterial growth. It has also been shown to inhibit the synthesis of guanine in DNA. 2-Methylthio-4-(tributylstannyl)pyrimidine is structurally similar to sulfamethoxazole, although it does not form a thiazolidine ring with the sulfur atom. This drug may act on bacterial ribonucleic acid (RNA) by preventing its synthesis and by inhibiting protein synthesis. 2-Methylthio-4-(tributylstannyl)pyrimidine binds to the ribosomal RNA of bacteria and inhibits protein synthesis by binding to the 50S ribosomal subunit. The nucleophilic nitrogen atoms are responsible for this binding.Formula:C17H32N2SSnPurity:Min. 95%Molecular weight:415.23 g/mol



