CAS 123067-52-7
:5-hydroxymethylblasticidin S
Description:
5-Hydroxymethylblasticidin S is a chemical compound that belongs to the class of antibiotics known as blasticidins, which are derived from the bacterium *Streptomyces griseochromogenes*. This compound is characterized by its unique structure, which includes a hydroxymethyl group that contributes to its biological activity. It exhibits potent antimicrobial properties, particularly against various strains of bacteria and fungi, making it of interest in pharmaceutical research. The mechanism of action typically involves inhibition of protein synthesis, which is crucial for bacterial growth and replication. Additionally, 5-hydroxymethylblasticidin S has been studied for its potential applications in cancer therapy due to its ability to interfere with cellular processes. Its solubility and stability in different solvents can vary, influencing its bioavailability and efficacy. As with many antibiotics, the development of resistance is a concern, prompting ongoing research into its use and the optimization of its derivatives for enhanced therapeutic effects.
Formula:C18H28N8O6
InChI:InChI=1/C18H28N8O6/c1-25(17(21)22)5-4-10(19)6-12(28)23-11-2-3-13(32-14(11)16(29)30)26-7-9(8-27)15(20)24-18(26)31/h2-3,7,10-11,13-14,27H,4-6,8,19H2,1H3,(H3,21,22)(H,23,28)(H,29,30)(H2,20,24,31)/t10-,11-,13?,14-/m0/s1
Synonyms:- 5-Hydroxymethylblasticidin S
- 4-amino-1-(4-{[(3S)-3-amino-5-(N-methylcarbamimidamido)pentanoyl]amino}-2,3,4-trideoxy-D-erythro-hex-2-enopyranuronosyl)-5-(hydroxymethyl)pyrimidin-2(1H)-one
- 5-Hydroxymethyl(blasticidin S)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Hydroxymethylblasticidin S
CAS:5-Hydroxymethylblasticidin S is a broad-spectrum antibiotic found in Streptomyces setonii.Formula:C18H28N8O6Color and Shape:SolidMolecular weight:452.465
