CAS 123071-42-1
:Malondialdehyde bis(phenylimine) monohydrochloride
Description:
Malondialdehyde bis(phenylimine) monohydrochloride is a chemical compound characterized by its structure, which includes a malondialdehyde backbone with two phenylimine groups and a hydrochloride moiety. This compound typically appears as a solid and is soluble in polar organic solvents. It is known for its role in various chemical reactions, particularly in the formation of imines and as a potential intermediate in organic synthesis. The presence of the bis(phenylimine) groups suggests that it may exhibit properties related to coordination chemistry, potentially interacting with metal ions. Additionally, malondialdehyde derivatives are often studied for their biological significance, particularly in relation to oxidative stress and cellular damage. The hydrochloride form indicates that the compound is a salt, which can influence its solubility and stability. Overall, malondialdehyde bis(phenylimine) monohydrochloride is of interest in both synthetic organic chemistry and biological research due to its unique structural features and potential reactivity.
Formula:C15H15ClN2
InChI:InChI=1/C15H14N2.ClH/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;/h1-6,8-13H,7H2;1H/b16-12+,17-13+;
Synonyms:- Malonaldehyde bis(phenylimine) monohydrochloride
- N,N'-(1E,3E)-propane-1,3-diylidenedianiline hydrochloride (1:1)
- Malonaldehyde dianilide hydrochloride
- Malondianil hydrochloride
- N,N'-(1E,3E)-prop-1-en-1-yl-3-ylidenedianiline hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Malonaldehyde bis(phenylimine) monohydrochloride, 97+%
CAS:<p>Malonaldehyde bis(phenylimine) monohydrochloride is a useful fluorescent cyanine dye. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item</p>Formula:C15H15ClN2Purity:97+%Color and Shape:Yellow to orange, PowderMolecular weight:258.75Malonaldehyde dianilide hydrochloride
CAS:Formula:C15H15ClN2Purity:97%Color and Shape:SolidMolecular weight:258.7460Malonaldehyde bis(phenylimine) monohydrochloride
CAS:<p>Malonaldehyde bis(phenylimine) monohydrochloride</p>Purity:98%Molecular weight:258.75g/molMalondialdehyde Bis(phenylimine) Monohydrochloride
CAS:Controlled ProductFormula:C15H14N2·HClColor and Shape:NeatMolecular weight:258.75





