CymitQuimica logo

CAS 123088-60-8

:

Boronic acid, [2-[(methylsulfonyl)methyl]phenyl]-

Description:
Boronic acid, specifically 2-[(methylsulfonyl)methyl]phenyl- (CAS 123088-60-8), is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also features a methylsulfonyl substituent. This compound typically exhibits a white to off-white crystalline solid form and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis, medicinal chemistry, and materials science. The methylsulfonyl group enhances the compound's solubility and reactivity, potentially influencing its biological activity and interactions. Additionally, boronic acids can participate in Suzuki coupling reactions, which are essential for constructing complex organic molecules. Overall, this compound's unique structure and functional properties make it a significant entity in both research and industrial applications.
Formula:C8H11BO4S
InChI:InChI=1S/C8H11BO4S/c1-14(12,13)6-7-4-2-3-5-8(7)9(10)11/h2-5,10-11H,6H2,1H3
InChI key:InChIKey=DNIAEPBELPHAHR-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(CS(C)(=O)=O)C=CC=C1
Synonyms:
  • [2-(Methanesulfonylmethyl)phenyl]boronic acid
  • Boronic acid, [2-[(methylsulfonyl)methyl]phenyl]-
  • (2-((Methylsulfonyl)methyl)phenyl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.