CAS 123123-32-0

Bullatacin

Description:

Bullatacin is a naturally occurring chemical compound classified as a potent alkaloid, primarily derived from certain species of the plant genus *Bollia*. It is known for its complex structure, which includes multiple rings and functional groups that contribute to its biological activity. Bullatacin exhibits significant pharmacological properties, particularly in the realm of neurobiology, where it has been studied for its potential effects on neurotransmitter systems. The compound has garnered interest for its possible applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its mechanism of action often involves modulation of specific receptors or enzymes, which can lead to various physiological effects. Additionally, Bullatacin's solubility and stability in different solvents can vary, influencing its bioavailability and efficacy in biological systems. As research continues, the full spectrum of its characteristics, including toxicity and potential side effects, is being explored to better understand its utility in pharmacology and toxicology.

Formula: C₃₇H₆₆O₇

InChI: InChI=1S/C37H66O7/c1-3-4-5-6-7-11-14-17-20-31(39)33-22-24-35(43-33)36-25-23-34(44-36)32(40)21-18-15-12-9-8-10-13-16-19-30(38)27-29-26-28(2)42-37(29)41/h26,28,30-36,38-40H,3-25,27H2,1-2H3/t28-,30+,31-,32+,33+,34+,35+,36+/m0/s1

InChI key: InChIKey=MBABCNBNDNGODA-LUVUIASKSA-N

SMILES: [C@H](CCCCCCCCCC[C@H](CC=1C(=O)O[C@@H](C)C1)O)(O)[C@@]2(O[C@](CC2)([C@@]3(O[C@@]([C@H](CCCCCCCCCC)O)(CC3)[H])[H])[H])[H]

Synonyms:

• Squamocin G
• 2(5H)-Furanone, 3-[2,13-dihydroxy-13-[octahydro-5′-(1-hydroxyundecyl)[2,2′-bifuran]-5-yl]tridecyl]-5-methyl-, [2R-[2α[2′R*,5′R*(S*)],5β[1(S*),2R*,13R*]]]-
• 2(5H)-Furanone, 3-[(2R,13R)-2,13-dihydroxy-13-[(2R,2′R,5R,5′R)-octahydro-5′-[(1S)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]tridecyl]-5-methyl-, (5S)-
• (5S)-3-[(2R,13R)-2,13-Dihydroxy-13-[(2R,2′R,5R,5′R)-octahydro-5′-[(1S)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]tridecyl]-5-methyl-2(5H)-furanone
• Bullatacin

Bullatacin

CAS: 123123-32-0

Formula: C₃₇H₆₆O₇

Purity: 95%

Color and Shape: Solid

Molecular weight: 622.9157

Ref: IN-DA01PRYW

Bullatacin

CAS: 123123-32-0

Bullatacin is a bis(tetrahydrofuranoid) fatty acid lactone that existed in some fruits from Annonaceae family.

Formula: C₃₇H₆₆O₇

Color and Shape: Solid

Molecular weight: 622.92

Ref: TM-T30613

(+)-bullatacin

CAS: 123123-32-0

Lactone

Formula: C₃₇H₆₆O₇

Purity: ≥ 90.0 % (HPLC)

Molecular weight: 622.92

Ref: 5G-25978