CymitQuimica logo

CAS 1231243-91-6

:

N-[4-[(2-Methoxyethyl)methylamino]phenyl]-2-phenyl-5-(trifluoromethyl)-4-oxazolecarboxamide

Description:
N-[4-[(2-Methoxyethyl)methylamino]phenyl]-2-phenyl-5-(trifluoromethyl)-4-oxazolecarboxamide is a synthetic organic compound characterized by its complex structure, which includes an oxazole ring, a trifluoromethyl group, and an amide functional group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings and a trifluoromethyl group, which can influence its solubility and permeability in biological systems. The methoxyethyl and methylamino substituents may enhance its interaction with biological targets, potentially affecting its pharmacological profile. The presence of the oxazole moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity. Overall, this compound's unique structural features may contribute to its potential utility in various chemical and biological applications, although specific biological activity and toxicity profiles would require further investigation through experimental studies.
Formula:C21H20F3N3O3
InChI:InChI=1S/C21H20F3N3O3/c1-27(12-13-29-2)16-10-8-15(9-11-16)25-19(28)17-18(21(22,23)24)30-20(26-17)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3,(H,25,28)
InChI key:InChIKey=GLLFNZDVMSLOCL-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(N(CCOC)C)C=C1)(=O)C2=C(C(F)(F)F)OC(=N2)C3=CC=CC=C3
Synonyms:
  • 4-Oxazolecarboxamide, N-[4-[(2-methoxyethyl)methylamino]phenyl]-2-phenyl-5-(trifluoromethyl)-
  • N-[4-[(2-Methoxyethyl)methylamino]phenyl]-2-phenyl-5-(trifluoromethyl)-4-oxazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.