CAS 1231244-43-1
:3-(3-Bromophenyl)-5-isoxazoleethanol
Description:
3-(3-Bromophenyl)-5-isoxazoleethanol is a chemical compound characterized by its unique structural features, which include a bromophenyl group and an isoxazole ring. The presence of the bromine atom in the phenyl group contributes to its reactivity and potential applications in medicinal chemistry. The isoxazole moiety is known for its biological activity, often serving as a scaffold in drug design due to its ability to interact with various biological targets. This compound is likely to exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential for hydrogen bonding due to the hydroxyl group. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound's characteristics may make it suitable for research in fields such as pharmacology and materials science, where its specific interactions and properties can be further explored. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of the bromine atom.
Formula:C11H10BrNO2
InChI:InChI=1S/C11H10BrNO2/c12-9-3-1-2-8(6-9)11-7-10(4-5-14)15-13-11/h1-3,6-7,14H,4-5H2
InChI key:InChIKey=XZFFRJCKPQSQSP-UHFFFAOYSA-N
SMILES:C(CO)C1=CC(=NO1)C2=CC(Br)=CC=C2
Synonyms:- 3-(3-Bromophenyl)-5-isoxazoleethanol
- 5-Isoxazoleethanol, 3-(3-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[3-(3-Bromo-phenyl)-isoxazol-5-yl]-ethanol
CAS:Controlled ProductFormula:C11H10BrNO2Color and Shape:NeatMolecular weight:268.107
