CymitQuimica logo

CAS 1231245-17-2

:

α,α-Dimethyl-3-phenoxybenzeneethanol

Description:
α,α-Dimethyl-3-phenoxybenzeneethanol is an organic compound characterized by its complex structure, which includes a phenoxy group and a secondary alcohol functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate solubility in organic solvents and potential hydrophobic characteristics due to its phenyl and alkyl groups. The presence of the hydroxyl (-OH) group suggests that it may engage in hydrogen bonding, influencing its boiling point and solubility in polar solvents. Additionally, the dimethyl substitution on the benzene ring can affect its reactivity and steric hindrance, potentially impacting its interactions in chemical reactions. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the environment in which the compound is used. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C16H18O2
InChI:InChI=1S/C16H18O2/c1-16(2,17)12-13-7-6-10-15(11-13)18-14-8-4-3-5-9-14/h3-11,17H,12H2,1-2H3
InChI key:InChIKey=OYPIWXPVTHBRCT-UHFFFAOYSA-N
SMILES:O(C1=CC(CC(C)(C)O)=CC=C1)C2=CC=CC=C2
Synonyms:
  • α,α-Dimethyl-3-phenoxybenzeneethanol
  • Benzeneethanol, α,α-dimethyl-3-phenoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.