CAS 123135-21-7
:N-glucopyranosyl-5-aminosalicylic acid
Description:
N-glucopyranosyl-5-aminosalicylic acid is a chemical compound that combines a glucopyranosyl moiety with 5-aminosalicylic acid, which is known for its anti-inflammatory properties and is commonly used in the treatment of inflammatory bowel diseases. This compound features a glucopyranose sugar unit linked to the amino salicylic acid, enhancing its solubility and potentially improving its bioavailability. The presence of the amino group and the carboxylic acid group in the structure contributes to its acidic nature and ability to form hydrogen bonds, which may influence its interaction with biological systems. N-glucopyranosyl-5-aminosalicylic acid may exhibit unique pharmacological properties compared to its parent compounds, potentially offering benefits in targeted drug delivery or reduced side effects. Its molecular structure allows for various chemical reactions, making it a subject of interest in medicinal chemistry and pharmaceutical research. As with many compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C13H17NO8
InChI:InChI=1/C13H17NO8/c15-4-8-9(17)10(18)11(19)12(22-8)14-5-1-2-7(16)6(3-5)13(20)21/h1-3,8-12,14-19H,4H2,(H,20,21)/t8-,9-,10+,11-,12-/m1/s1
Synonyms:- N-Beta-D-Glucopyranosyl-5-Aminosalicylicacid
- N-(3-carboxy-4-hydroxyphenyl)-beta-D-glucopyranosylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-D-Glucopyranosyl-5-aminosalicylic acid
CAS:N-D-Glucopyranosyl-5-aminosalicylic acidPurity:>95%Molecular weight:315.28g/mol5-(N-β-D-Glucopyranosylamino) Salicylic Acid
CAS:Formula:C13H17NO8Color and Shape:Off-White SolidMolecular weight:315.28Mesalazine N-β-D-Glucoside
CAS:Controlled ProductFormula:C13H17NO8Color and Shape:NeatMolecular weight:315.276N-D-Glucopyranosyl-5-aminosalicylic acid
CAS:5-Aminosalicylic acid (5-ASA) is an anti-inflammatory drug that belongs to the class of drugs called nonsteroidal anti-inflammatory drugs (NSAIDs). 5-ASA is an acidic compound that is a metabolite of salicylic acid. It is used in the treatment of rheumatoid arthritis, osteoarthritis, and other inflammatory diseases. The preparation of 5-ASA involves homogenizing liver tissue and then extracting it with water. This extract can be chromatographed using preparative high performance liquid chromatography (HPLC) or spectroscopically analyzed by mass spectrometry. 5-ASA has been shown to have hepatoprotective effects in rats when given at a dose of 400 mg/kg body weight by intraperitoneal injection.
Formula:C13H17NO8Purity:Min. 95%Molecular weight:315.28 g/mol





