CAS 123155-04-4
:2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin
Description:
2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin is a modified derivative of β-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units. This compound features specific functional groups that enhance its solubility and stability, making it useful in various applications, particularly in drug delivery and formulation. The presence of two methoxy groups at the 2 and 3 positions and a tert-butyldimethylsilyl group at the 6 position significantly alters its chemical properties, allowing for improved interaction with hydrophobic molecules. This modification increases the lipophilicity of the cyclodextrin, facilitating the encapsulation of poorly soluble drugs. Additionally, the bulky silyl group provides steric protection, which can enhance the stability of the compound under various conditions. The unique structure of this compound allows it to form inclusion complexes, making it valuable in pharmaceutical applications, such as enhancing the bioavailability of active pharmaceutical ingredients. Overall, 2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin is characterized by its modified solubility, stability, and ability to form complexes with various guest molecules.
Formula:C98H196O35Si7
InChI:InChI=1S/C98H196O35Si7/c1-92(2,3)134(36,37)113-50-57-64-71(99-22)78(106-29)85(120-57)128-65-58(51-114-135(38,39)93(4,5)6)122-87(80(108-31)72(65)100-23)130-67-60(53-116-137(42,43)95(10,11)12)124-89(82(110-33)74(67)102-25)132-69-62(55-118-139(46,47)97(16,17)18)126-91(84(112-35)76(69)104-27)133-70-63(56-119-140(48,49)98(19,20)21)125-90(83(111-34)77(70)105-28)131-68-61(54-117-138(44,45)96(13,14)15)123-88(81(109-32)75(68)103-26)129-66-59(52-115-136(40,41)94(7,8)9)121-86(127-64)79(107-30)73(66)101-24/h57-91H,50-56H2,1-49H3/t57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71+,72+,73+,74+,75+,76+,77+,78-,79-,80-,81-,82-,83-,84-,85-,86-,87-,88-,89-,90-,91-/m1/s1
InChI key:InChIKey=YJLSGORJJHKFEN-CUVGCOKVSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)[C@@H]1[C@@]2([C@H](OC)[C@@H](OC)[C@](O1)(O[C@@]3([C@@H](CO[Si](C(C)(C)C)(C)C)O[C@@]([C@H](OC)[C@H]3OC)(O[C@@]4([C@@H](CO[Si](C(C)(C)C)(C)C)O[C@@]([C@H](OC)[C@H]4OC)(O[C@@]5([C@@H](CO[Si](C(C)(C)C)(C)C)O[C@](O[C@]6([C@H](OC)[C@@H](OC)[C@@](O[C@]7([C@H](OC)[C@@H](OC)[C@@](O[C@]8([C@H](OC)[C@@H](OC)[C@@](O2)(O[C@@H]8CO[Si](C(C)(C)C)(C)C)[H])[H])(O[C@@H]7CO[Si](C(C)(C)C)(C)C)[H])[H])(O[C@@H]6CO[Si](C(C)(C)C)(C)C)[H])[H])([C@H](OC)[C@H]5OC)[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- β-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G-heptakis-O-[(1,1-dimethylethyl)dimethylsilyl]-2A,2B,2C,2D,2E,2F,2G,3A,3B,3C,3D,3E,3F,3G-tetradeca-O-methyl-
- 6A,6B,6C,6D,6E,6F,6G-Heptakis-O-[(1,1-dimethylethyl)dimethylsilyl]-2A,2B,2C,2D,2E,2F,2G,3A,3B,3C,3D,3E,3F,3G-tetradeca-O-methyl-β-cyclodextrin
- Heptakis(6-O-tert-butyldimethylsilyl-2,3-di-O-methyl)-β-cyclodextrin
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane, β-cyclodextrin deriv.
- 2,3-Di-O-methyl-6-O-tert-butyldimethylsilyl β-cyclodextrin
- Heptakis(2,3-di-O-Methyl-6-O-tert-butyldiMethylsilyl)cycloMaltoheptaose.
- Heptakis(2,3-di-O-Methyl-6-O-tert-butyldiMethylsilyl)-β-cyclodextrin
- 2,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Heptakis(2,3-di-O-methyl-6-O-tert-butyldimethylsilyl)-β-cyclodextrin
CAS:Controlled Product<p>Applications A β-Cyclodextrin derivative.<br>References Yan, D., et al.: Science, 303, 65 (2004), Gou, P.-F., et al.: Biomacromolecules, 11, 934 (2010),<br></p>Formula:C98H196O35Si7Color and Shape:WhiteMolecular weight:2131.182,3-Dimethyl-6-tert-butyldimethylsilyl-b-cyclodextrin
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C98H196O35Si7Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:2,131.18 g/mol


