CAS 123155-06-6
:Octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin
Description:
Octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin is a modified form of γ-cyclodextrin, a cyclic oligosaccharide composed of eight glucose units. This compound features tert-butyldimethylsilyl groups attached to the hydroxyl groups at the 6-position of the glucose units, enhancing its hydrophobic properties and stability. The introduction of these silyl groups increases the lipophilicity of the molecule, making it useful for encapsulating hydrophobic compounds, which can improve their solubility and bioavailability. This modification also provides resistance to enzymatic degradation, making it suitable for various applications in pharmaceuticals, food science, and materials chemistry. The structural characteristics of octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin allow it to form inclusion complexes, which can be utilized in drug delivery systems and controlled release formulations. Additionally, its unique properties may facilitate the formation of nanocarriers and enhance the stability of sensitive compounds. Overall, this compound represents a versatile tool in the field of supramolecular chemistry and nanotechnology.
Formula:C96H192O40Si8
InChI:InChI=1S/C96H192O40Si8/c1-89(2,3)137(25,26)113-41-49-73-57(97)65(105)81(121-49)130-74-50(42-114-138(27,28)90(4,5)6)123-83(67(107)59(74)99)132-76-52(44-116-140(31,32)92(10,11)12)125-85(69(109)61(76)101)134-78-54(46-118-142(35,36)94(16,17)18)127-87(71(111)63(78)103)136-80-56(48-120-144(39,40)96(22,23)24)128-88(72(112)64(80)104)135-79-55(47-119-143(37,38)95(19,20)21)126-86(70(110)62(79)102)133-77-53(45-117-141(33,34)93(13,14)15)124-84(68(108)60(77)100)131-75-51(43-115-139(29,30)91(7,8)9)122-82(129-73)66(106)58(75)98/h49-88,97-112H,41-48H2,1-40H3/t49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-,85-,86-,87-,88-/m1/s1
InChI key:InChIKey=MKSDSPVSZRMRNY-YKBAZCJNSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)[C@@H]1[C@]2(O[C@]3(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]3O)(O[C@]4(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]4O)(O[C@]5(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]5O)(O[C@]6(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]7(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]8(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]9(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@@](O1)([C@H](O)[C@H]2O)[H])([C@H](O)[C@H]9O)[H])[H])([C@H](O)[C@H]8O)[H])[H])([C@H](O)[C@H]7O)[H])[H])([C@H](O)[C@H]6O)[H])[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- Octa-(6-oxy-tert-butyl-dimethylsilyl)-γ-cyclodextrin
- Octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-Hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane, γ-cyclodextrin deriv.
- γ-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G,6H-octakis-O-[(1,1-dimethylethyl)dimethylsilyl]-
- 6A,6B,6C,6D,6E,6F,6G,6H-Octakis-O-[(1,1-dimethylethyl)dimethylsilyl]-γ-cyclodextrin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-O-tert-butyldimethylsilyl-γ-cyclodextrin
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C96H192O40Si8Purity:Min. 95%Molecular weight:2,211.21 g/mol
