CymitQuimica logo

CAS 123158-77-0

:

2-Iodo-4-methyl-6-nitrobenzenamine

Description:
2-Iodo-4-methyl-6-nitrobenzenamine is an organic compound characterized by the presence of an amino group (-NH2), an iodine atom, a methyl group (-CH3), and a nitro group (-NO2) attached to a benzene ring. The molecular structure indicates that it is a substituted aniline, where the amino group is directly bonded to the aromatic ring, influencing its reactivity and properties. The iodine substituent typically enhances the compound's electrophilic character, making it more reactive in nucleophilic substitution reactions. The nitro group, being a strong electron-withdrawing group, can significantly affect the compound's acidity and reactivity, often increasing the electrophilicity of the aromatic system. Additionally, the presence of the methyl group can introduce steric effects that may influence the compound's reactivity and solubility. Overall, 2-Iodo-4-methyl-6-nitrobenzenamine is likely to exhibit properties typical of halogenated aromatic amines, including potential applications in organic synthesis and materials science, while also necessitating careful handling due to the presence of the nitro group, which can pose health and environmental risks.
Formula:C7H7IN2O2
InChI:InChI=1S/C7H7IN2O2/c1-4-2-5(8)7(9)6(3-4)10(11)12/h2-3H,9H2,1H3
InChI key:InChIKey=MCALXGRQNXDTPI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)C(I)=CC(C)=C1
Synonyms:
  • 2-Iodo-4-methyl-6-nitrobenzenamine
  • Benzenamine, 2-iodo-4-methyl-6-nitro-
  • 2-Iodo-4-methyl-6-nitroaniline
  • 4-Amino-5-iodo-3-nitrotoluene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.