CymitQuimica logo

CAS 123174-58-3

:

GC-R2 etherate

Description:
GC-R2 etherate, identified by its CAS number 123174-58-3, is a chemical compound that typically serves as a reagent in various synthetic applications, particularly in organic chemistry. It is characterized by its etherate form, which suggests the presence of ether groups that can influence its solubility and reactivity. This compound is often utilized in coordination chemistry and may act as a Lewis acid or base, depending on the context of its use. Its etherate nature can enhance the stability of certain metal complexes, making it valuable in catalysis and other chemical transformations. Additionally, GC-R2 etherate may exhibit specific physical properties such as volatility and a distinct boiling point, which are important for its handling and application in laboratory settings. Safety data sheets should be consulted for information on toxicity, handling precautions, and environmental impact, as with any chemical substance. Overall, GC-R2 etherate is a versatile compound with significant utility in chemical synthesis and research.
Formula:C72H58N2O8
InChI:InChI=1S/C72H58N2O8/c1-39(2)47-31-21-32-48(40(3)4)67(47)73-69(75)51-35-55(79-43-23-13-9-14-24-43)61-63-57(81-45-27-17-11-18-28-45)37-53-60-54(72(78)74(71(53)77)68-49(41(5)6)33-22-34-50(68)42(7)8)38-58(82-46-29-19-12-20-30-46)64(66(60)63)62-56(80-44-25-15-10-16-26-44)36-52(70(73)76)59(51)65(61)62/h9-42H,1-8H3
InChI key:ZZSIDSMUTXFKNS-UHFFFAOYSA-N
SMILES:CC(C)C1=C(C(=CC=C1)C(C)C)N2C(=O)C3=CC(=C4C5=C(C=C6C7=C5C(=C(C=C7C(=O)N(C6=O)C8=C(C=CC=C8C(C)C)C(C)C)OC9=CC=CC=C9)C1=C(C=C(C3=C41)C2=O)OC1=CC=CC=C1)OC1=CC=CC=C1)OC1=CC=CC=C1
Found 6 products.