
CAS 1231761-03-7
:6-Quinazolinecarbonitrile
Description:
6-Quinazolinecarbonitrile is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. The presence of a cyano group (-C≡N) at the 6-position of the quinazoline ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a crystalline solid, exhibiting moderate solubility in polar organic solvents. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry for the development of therapeutic agents. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, due to the presence of the cyano group, 6-quinazolinecarbonitrile may participate in nucleophilic reactions, expanding its utility in synthetic organic chemistry. Overall, its unique structural features and functional groups make it a valuable compound for research and development in various chemical applications.
Formula:C9H5N3
InChI:InChI=1S/C9H5N3/c10-4-7-1-2-9-8(3-7)5-11-6-12-9/h1-3,5-6H
InChI key:InChIKey=XAIQADWTFHMCOS-UHFFFAOYSA-N
SMILES:C(#N)C1=CC2=C(C=C1)N=CN=C2
Synonyms:- 6-Quinazolinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.